N-[(4-propan-2-ylphenyl)methylideneamino]pyridine-4-carboxamide structure
|
Common Name | N-[(4-propan-2-ylphenyl)methylideneamino]pyridine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 17346-07-5 | Molecular Weight | 267.32600 | |
| Density | 1.1g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(E)-(4-propan-2-ylphenyl)methylideneamino]pyridine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.32600 |
| Exact Mass | 267.13700 |
| PSA | 54.35000 |
| LogP | 3.35980 |
| Index of Refraction | 1.58 |
| InChIKey | DQCYGHZYQXQFRU-WQRHYEAKSA-N |
| SMILES | CC(C)c1ccc(C=NNC(=O)c2ccncc2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-{(1E)-2-[4-(methylethyl)phenyl]-1-azavinyl}-4-pyridylcarboxamide |
| N'-{(E)-[4-(propan-2-yl)phenyl]methylidene}pyridine-4-carbohydrazide |
| N'-(4-Isopropyl Benzylidene)Isonicotinohydrazide |
| isonicotinic acid-(4-isopropyl-benzylidenehydrazide) |
| Isonicotinsaeure-(4-isopropyl-benzylidenhydrazid) |
| Cuminaldehyd-isonicotinoylhydrazon |