Trifluoroacetic acid 3-methylphenyl ester structure
|
Common Name | Trifluoroacetic acid 3-methylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 1736-09-0 | Molecular Weight | 204.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methylphenyl trifluoroacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7F3O2 |
|---|---|
| Molecular Weight | 204.14600 |
| Exact Mass | 204.04000 |
| PSA | 26.30000 |
| LogP | 2.46270 |
| Vapour Pressure | 2mmHg at 25°C |
| InChIKey | FXNFSBCSHQEHSB-UHFFFAOYSA-N |
| SMILES | Cc1cccc(OC(=O)C(F)(F)F)c1 |
| HS Code | 2915900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Trifluoressigsaeure-m-cresylester |
| Trifluor-essigsaeure-m-tolylester |
| m-Methylphenyltrifluoracetat |
| trifluoro-acetic acid m-tolyl ester |