6-chloro-1-ethyl-2-methyl-5-(trifluoromethyl)-1H-benzimidazole structure
|
Common Name | 6-chloro-1-ethyl-2-methyl-5-(trifluoromethyl)-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 1736-34-1 | Molecular Weight | 262.65900 | |
| Density | 1.38g/cm3 | Boiling Point | 348.1ºC at 760mmHg | |
| Molecular Formula | C11H10ClF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.3ºC | |
| Name | 6-chloro-1-ethyl-2-methyl-5-(trifluoromethyl)benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 348.1ºC at 760mmHg |
| Molecular Formula | C11H10ClF3N2 |
| Molecular Weight | 262.65900 |
| Flash Point | 164.3ºC |
| Exact Mass | 262.04800 |
| PSA | 17.82000 |
| LogP | 4.03680 |
| Vapour Pressure | 0.000104mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | ZINJVKDSCBDJRX-UHFFFAOYSA-N |
| SMILES | CCn1c(C)nc2cc(C(F)(F)F)c(Cl)cc21 |
| HS Code | 2933990090 |
|---|
|
~%
6-chloro-1-ethy... CAS#:1736-34-1 |
| Literature: United States Borax and Chemical Corporation Patent: US3954788 A1, 1976 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Benzimidazole,6-chloro-1-ethyl-2-methyl-5-(trifluoromethyl) |
| 6-Chloro-1-ethyl-2-methyl-5-(trifluoromethyl)-1H-benzimidazole |
| 6-Chlor-1-aethyl-2-methyl-5-trifluormethylbenzimidazol |
| 6-Chlor-2-methyl-5-trifluormethyl-1-ethyl-benzimidazol |
| 6-chloro-1-ethyl-2-methyl-5-trifluoromethyl-1H-benzoimidazole |
| 6-chloro-1-ethyl-2-methyl-5-trifluoromethylbenzimidazole |