Benzamide,N,N-bis(2-chloroethyl)-4-fluoro
Modify Date: 2026-07-12 11:47:18
Benzamide,N,N-bis(2-chloroethyl)-4-fluoro structure
|
Common Name | Benzamide,N,N-bis(2-chloroethyl)-4-fluoro | ||
|---|---|---|---|---|
| CAS Number | 1736-40-9 | Molecular Weight | 264.12300 | |
| Density | 1.29g/cm3 | Boiling Point | 387.1ºC at 760mmHg | |
| Molecular Formula | C11H12Cl2FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.9ºC | |
| Name | N,N-bis(2-chloroethyl)-4-fluorobenzamide |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 387.1ºC at 760mmHg |
| Molecular Formula | C11H12Cl2FNO |
| Molecular Weight | 264.12300 |
| Flash Point | 187.9ºC |
| Exact Mass | 263.02800 |
| PSA | 20.31000 |
| LogP | 2.74550 |
| Vapour Pressure | 3.37E-06mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | QFDYYVBJXLFPNP-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)N(CCCl)CCCl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1