(4R)-4-(Diphenylmethyl)-1,3-oxazolidin-2-one structure
|
Common Name | (4R)-4-(Diphenylmethyl)-1,3-oxazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 173604-33-6 | Molecular Weight | 253.296 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 472.6±15.0 °C at 760 mmHg | |
| Molecular Formula | C16H15NO2 | Melting Point | 145-148ºC(lit.) | |
| MSDS | N/A | Flash Point | 239.6±20.4 °C | |
| Name | (4R)-4-benzhydryl-1,3-oxazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 472.6±15.0 °C at 760 mmHg |
| Melting Point | 145-148ºC(lit.) |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.296 |
| Flash Point | 239.6±20.4 °C |
| Exact Mass | 253.110275 |
| PSA | 38.33000 |
| LogP | 3.39 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | QEOCTJMBYZNEJH-AWEZNQCLSA-N |
| SMILES | O=C1NC(C(c2ccccc2)c2ccccc2)CO1 |
|
~79%
(4R)-4-(Dipheny... CAS#:173604-33-6 |
| Literature: Takacs; Jaber; Vellekoop Journal of Organic Chemistry, 1998 , vol. 63, # 8 p. 2742 - 2748 |
|
~78%
(4R)-4-(Dipheny... CAS#:173604-33-6 |
| Literature: Sibi, Mukund P.; Deshpande, Prasad K.; Loggia, Anthony J. La; Christensen, James W. Tetrahedron Letters, 1995 , vol. 36, # 49 p. 8961 - 8964 |
|
~%
(4R)-4-(Dipheny... CAS#:173604-33-6
Detail
|
| Literature: Journal of Organic Chemistry, , vol. 62, # 17 p. 5864 - 5872 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| (4R)-4-(Diphenylmethyl)-1,3-oxazolidin-2-one |
| 2-Oxazolidinone, 4-(diphenylmethyl)-, (4R)- |
| 4-Diphenylmethyloxazolidin-2-one |
| (R)-(+)-4-(Diphenylmethyl)-2-oxazolidinone |
| MFCD01863565 |
| 4-diphenylmethyl-2-oxazolidinone |