2-hydroxy-,5-nitro-, 4-nitrophenyl ester structure
|
Common Name | 2-hydroxy-,5-nitro-, 4-nitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 17374-49-1 | Molecular Weight | 304.21200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl) 2-hydroxy-5-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8N2O7 |
|---|---|
| Molecular Weight | 304.21200 |
| Exact Mass | 304.03300 |
| PSA | 138.17000 |
| LogP | 3.47420 |
| InChIKey | RKASYGMMWOLFLI-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)c1cc([N+](=O)[O-])ccc1O |
| HS Code | 2918290000 |
|---|
|
~%
2-hydroxy-,5-ni... CAS#:17374-49-1 |
| Literature: Tozer; Smiles Journal of the Chemical Society, 1938 , p. 1897,1899 |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 4-Nitrophenyl-5-nitrosalicylat |
| BEN121 |
| Benzoicacid,2-hydroxy-,5-nitro-,4-nitrophenyl ester |