2-benzamido-3-methyl-but-2-enoic acid structure
|
Common Name | 2-benzamido-3-methyl-but-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 1738-64-3 | Molecular Weight | 219.23700 | |
| Density | 1.193g/cm3 | Boiling Point | 478.9ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.5ºC | |
| Name | 2-benzamido-3-methylbut-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 478.9ºC at 760 mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.23700 |
| Flash Point | 243.5ºC |
| Exact Mass | 219.09000 |
| PSA | 66.40000 |
| LogP | 2.18580 |
| Vapour Pressure | 5.55E-10mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | JOPORVSSFJWMSB-UHFFFAOYSA-N |
| SMILES | CC(C)=C(NC(=O)c1ccccc1)C(=O)O |
|
~%
2-benzamido-3-m... CAS#:1738-64-3 |
| Literature: Kotschetkow et al. Zhurnal Obshchei Khimii, 1959 , vol. 29, p. 4069,4075; engl. Ausg. S. 4030, 4034 |
|
~%
2-benzamido-3-m... CAS#:1738-64-3 |
| Literature: Kalle A.G. Patent: DE830790 , 1951 ; DRP/DRBP Org.Chem. |
|
~%
2-benzamido-3-m... CAS#:1738-64-3 |
| Literature: Kalle A.G. Patent: DE830790 , 1951 ; DRP/DRBP Org.Chem. |
|
~%
2-benzamido-3-m... CAS#:1738-64-3 |
| Literature: Kalle A.G. Patent: DE830790 , 1951 ; DRP/DRBP Org.Chem. |
|
~%
2-benzamido-3-m... CAS#:1738-64-3 |
| Literature: Ramage; Simonsen Journal of the Chemical Society, 1935 , p. 532,533 |
| 2-benzoylamino-3-methyl-crotonic acid |
| 2-Benzoylamino-3-methyl-crotonsaeure |