1-Phenylcyclohexane-1-carboxylic acid methyl ester structure
|
Common Name | 1-Phenylcyclohexane-1-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 17380-78-8 | Molecular Weight | 218.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1-phenylcyclohexane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O2 |
|---|---|
| Molecular Weight | 218.29200 |
| Exact Mass | 218.13100 |
| PSA | 26.30000 |
| LogP | 3.06150 |
| InChIKey | SGCPKFJYODXFOZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(c2ccccc2)CCCCC1 |
| HS Code | 2916399090 |
|---|
|
~48%
1-Phenylcyclohe... CAS#:17380-78-8 |
| Literature: WO2013/25733 A1, ; Paragraph 0743 ; |
|
~85%
1-Phenylcyclohe... CAS#:17380-78-8 |
| Literature: US2009/124806 A1, ; Page/Page column 5-6 ; |
|
~90%
1-Phenylcyclohe... CAS#:17380-78-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 34, # 11 p. 3159 - 3164 |
|
~98%
1-Phenylcyclohe... CAS#:17380-78-8 |
| Literature: Chemical Communications, , # 13 p. 1739 - 1741 |
|
~%
1-Phenylcyclohe... CAS#:17380-78-8 |
| Literature: Synthesis, , # 23 art. no. F16908SS, p. 3835 - 3845 |
|
~%
1-Phenylcyclohe... CAS#:17380-78-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 34, # 11 p. 3159 - 3164 |
|
~%
1-Phenylcyclohe... CAS#:17380-78-8 |
| Literature: WO2013/25733 A1, ; |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| methyl 1-phenyl-1-cyclohexanecarboxylate |
| 1-Phenylcyclohexane-1-carboxylic acid methyl ester |
| Cyclohexanecarboxylic acid,1-phenyl-,methyl ester |
| 1-Phenylcyclohexan-1-carbonsaeure-methylester |
| methyl 1-phenylcyclohexanecarboxylate |
| methyl 1-phenylcyclohexancarboxylate |