Cyclopropanemethanol, a,a-bis(1-methylethyl)-, 1-(4-nitrobenzoate) structure
|
Common Name | Cyclopropanemethanol, a,a-bis(1-methylethyl)-, 1-(4-nitrobenzoate) | ||
|---|---|---|---|---|
| CAS Number | 17397-11-4 | Molecular Weight | 305.36900 | |
| Density | 1.157g/cm3 | Boiling Point | 410.7ºC at 760 mmHg | |
| Molecular Formula | C17H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.3ºC | |
| Name | (3-cyclopropyl-2,4-dimethylpentan-3-yl) 4-nitrobenzoate |
|---|
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 410.7ºC at 760 mmHg |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.36900 |
| Flash Point | 153.3ºC |
| Exact Mass | 305.16300 |
| PSA | 72.12000 |
| LogP | 4.73560 |
| Vapour Pressure | 5.92E-07mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | MUSYICBRKHFTOR-UHFFFAOYSA-N |
| SMILES | CC(C)C(OC(=O)c1ccc([N+](=O)[O-])cc1)(C(C)C)C1CC1 |
|
~%
Cyclopropanemet... CAS#:17397-11-4 |
| Literature: Journal of Organic Chemistry, , vol. 33, p. 4054 - 4060 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |