Perforamone D structure
|
Common Name | Perforamone D | ||
|---|---|---|---|---|
| CAS Number | 17398-11-7 | Molecular Weight | 274.26900 | |
| Density | 1.359g/cm3 | Boiling Point | 512.3ºC at 760 mmHg | |
| Molecular Formula | C15H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.1ºC | |
| Name | 5-hydroxy-2-(hydroxymethyl)-8,8-dimethylpyrano[2,3-h]chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.359g/cm3 |
|---|---|
| Boiling Point | 512.3ºC at 760 mmHg |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.26900 |
| Flash Point | 197.1ºC |
| Exact Mass | 274.08400 |
| PSA | 79.90000 |
| LogP | 2.17510 |
| Vapour Pressure | 2.56E-11mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | QLDUXSCWWAQMTC-UHFFFAOYSA-N |
| SMILES | CC1(C)C=Cc2c(cc(O)c3c(=O)cc(CO)oc23)O1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ptaerochromenol |
| 2-hydroxymethylalloptaeroxylin |
| Ptaerocromenol |
| perforamone D |
| greveichromenol |