1-nitro-3-(3-phenoxypropoxy)benzene structure
|
Common Name | 1-nitro-3-(3-phenoxypropoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 17399-23-4 | Molecular Weight | 273.28400 | |
| Density | 1.205g/cm3 | Boiling Point | 421.9ºC at 760 mmHg | |
| Molecular Formula | C15H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.4ºC | |
| Name | 1-nitro-3-(3-phenoxypropoxy)benzene |
|---|
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 421.9ºC at 760 mmHg |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.28400 |
| Flash Point | 179.4ºC |
| Exact Mass | 273.10000 |
| PSA | 64.28000 |
| LogP | 3.96590 |
| Vapour Pressure | 6.16E-07mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | JCXYOTRMYJMLSI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(OCCCOc2ccccc2)c1 |
|
~%
1-nitro-3-(3-ph... CAS#:17399-23-4 |
| Literature: Baker; Lourens Journal of pharmaceutical sciences, 1967 , vol. 56, # 7 p. 871 - 875 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |