Benzenesulfonamide,4-methyl-N-[(3-nitrophenyl)methyl]- structure
|
Common Name | Benzenesulfonamide,4-methyl-N-[(3-nitrophenyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 17400-36-1 | Molecular Weight | 306.33700 | |
| Density | 1.338g/cm3 | Boiling Point | 501.4ºC at 760mmHg | |
| Molecular Formula | C14H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257ºC | |
| Name | 4-methyl-N-[(3-nitrophenyl)methyl]benzenesulfonamide |
|---|
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 501.4ºC at 760mmHg |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.33700 |
| Flash Point | 257ºC |
| Exact Mass | 306.06700 |
| PSA | 100.37000 |
| LogP | 4.37660 |
| Vapour Pressure | 3.5E-10mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | CCAKBSJQJAVJQW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NCc2cccc([N+](=O)[O-])c2)cc1 |
|
~91%
Benzenesulfonam... CAS#:17400-36-1 |
| Literature: Hojo, Makoto; Murakami, Chikara; Fujii, Atsuko; Hosomi, Akira Tetrahedron Letters, 1999 , vol. 40, # 5 p. 911 - 914 |
|
~%
Benzenesulfonam... CAS#:17400-36-1 |
| Literature: Baker,B.R.; Coward,J.K. Journal of Heterocyclic Chemistry, 1967 , vol. 4, p. 202 - 208 |
|
~%
Benzenesulfonam... CAS#:17400-36-1 |
| Literature: Baker,B.R.; Coward,J.K. Journal of Heterocyclic Chemistry, 1967 , vol. 4, p. 202 - 208 |