3-(1-methyl-1,2,3,6-tetrahydropyrid-4-yl)indole structure
|
Common Name | 3-(1-methyl-1,2,3,6-tetrahydropyrid-4-yl)indole | ||
|---|---|---|---|---|
| CAS Number | 17403-03-1 | Molecular Weight | 212.29000 | |
| Density | 1.144g/cm3 | Boiling Point | 391.1ºC at 760mmHg | |
| Molecular Formula | C14H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.3ºC | |
| Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 391.1ºC at 760mmHg |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.29000 |
| Flash Point | 190.3ºC |
| Exact Mass | 212.13100 |
| PSA | 19.03000 |
| LogP | 2.82470 |
| Vapour Pressure | 2.52E-06mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | IUENQRYBZHHPBN-UHFFFAOYSA-N |
| SMILES | CN1CC=C(c2c[nH]c3ccccc23)CC1 |
| HS Code | 2933990090 |
|---|
|
~81%
3-(1-methyl-1,2... CAS#:17403-03-1 |
| Literature: NYCOMED GMBH; BARTELS, Bjoern; WEINBRENNER, Steffen; MARX, Degenhard; DIEFENBACH, Joerg; DUNKERN, Torsten; MENGE, Wiro M.P.B.; CHRISTIAANS, Johannes A. M. Patent: WO2010/15588 A1, 2010 ; Location in patent: Page/Page column 105-106 ; WO 2010/015588 A1 |
|
~%
3-(1-methyl-1,2... CAS#:17403-03-1 |
| Literature: Allelix Biopharmaceuticals Inc. Patent: US6133287 A1, 2000 ; US 6133287 A |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Mtpi |