benzenamine, 2,4-bis(1-methyl-1-phenylethyl)-n-[4-(1-methyl-1-phenylethyl)pheny structure
|
Common Name | benzenamine, 2,4-bis(1-methyl-1-phenylethyl)-n-[4-(1-methyl-1-phenylethyl)pheny | ||
|---|---|---|---|---|
| CAS Number | 17419-19-1 | Molecular Weight | 523.75000 | |
| Density | 1.057g/cm3 | Boiling Point | 609.3ºC at 760mmHg | |
| Molecular Formula | C39H41N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.8ºC | |
| Name | 2,4-bis(2-phenylpropan-2-yl)-N-[4-(2-phenylpropan-2-yl)phenyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.057g/cm3 |
|---|---|
| Boiling Point | 609.3ºC at 760mmHg |
| Molecular Formula | C39H41N |
| Molecular Weight | 523.75000 |
| Flash Point | 336.8ºC |
| Exact Mass | 523.32400 |
| PSA | 12.03000 |
| LogP | 10.48090 |
| Vapour Pressure | 8.65E-15mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | CNNKURHFWJWJER-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccccc1)c1ccc(Nc2ccc(C(C)(C)c3ccccc3)cc2C(C)(C)c2ccccc2)cc1 |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,4-(1-Methyl-1-phenylethyl)-N-(4-(1-methyl-1-phenylethyl)phenyl)benzenamine |
| Benzenamine,2,4-bis(1-methyl-1-phenylethyl)-N-(4-(1-methyl-1-phenylethyl)phenyl) |