1-phenyl-4-[(4-phenylpiperazin-1-yl)methyl]piperazine structure
|
Common Name | 1-phenyl-4-[(4-phenylpiperazin-1-yl)methyl]piperazine | ||
|---|---|---|---|---|
| CAS Number | 17419-71-5 | Molecular Weight | 336.47400 | |
| Density | 1.124g/cm3 | Boiling Point | 484.7ºC at 760 mmHg | |
| Molecular Formula | C21H28N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.7ºC | |
| Name | 1-phenyl-4-[(4-phenylpiperazin-1-yl)methyl]piperazine |
|---|
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 484.7ºC at 760 mmHg |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.47400 |
| Flash Point | 210.7ºC |
| Exact Mass | 336.23100 |
| PSA | 12.96000 |
| LogP | 2.59410 |
| Vapour Pressure | 1.5E-09mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | OYSWGVYILLGXLT-UHFFFAOYSA-N |
| SMILES | c1ccc(N2CCN(CN3CCN(c4ccccc4)CC3)CC2)cc1 |
|
~%
1-phenyl-4-[(4-... CAS#:17419-71-5 |
| Literature: Forsee; Pollard Journal of the American Chemical Society, 1935 , vol. 57, p. 2363 |
|
~%
1-phenyl-4-[(4-... CAS#:17419-71-5 |
| Literature: Morlacchi; Trapani; Losacco; Armenise Farmaco, Edizione Scientifica, 1985 , vol. 40, # 9 p. 671 - 682 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |