3'-trifluoro-N-methyl-4-phenyl-1,2,3,6-tetrahydropyridine structure
|
Common Name | 3'-trifluoro-N-methyl-4-phenyl-1,2,3,6-tetrahydropyridine | ||
|---|---|---|---|---|
| CAS Number | 17421-02-2 | Molecular Weight | 241.25200 | |
| Density | 1.168g/cm3 | Boiling Point | 282.2ºC at 760mmHg | |
| Molecular Formula | C13H14F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.4ºC | |
| Name | 1-methyl-4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 282.2ºC at 760mmHg |
| Molecular Formula | C13H14F3N |
| Molecular Weight | 241.25200 |
| Flash Point | 124.4ºC |
| Exact Mass | 241.10800 |
| PSA | 3.24000 |
| LogP | 3.36220 |
| Vapour Pressure | 0.00341mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | QHJMMGUDIYSLIX-UHFFFAOYSA-N |
| SMILES | CN1CC=C(c2cccc(C(F)(F)F)c2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3'-Trifluoro-N-methyl-4-phenyl-1,2,3,6-tetrahydropyridine |