Ethyl 3-(2,4-dichloro-5-nitrophenyl)-3-oxopropanoate structure
|
Common Name | Ethyl 3-(2,4-dichloro-5-nitrophenyl)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 174312-93-7 | Molecular Weight | 306.09900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9Cl2NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 3-(2,4-dichloro-5-nitrophenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9Cl2NO5 |
|---|---|
| Molecular Weight | 306.09900 |
| Exact Mass | 304.98600 |
| PSA | 89.19000 |
| LogP | 3.56070 |
| InChIKey | UCLHXGMQGGFJNJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cc([N+](=O)[O-])c(Cl)cc1Cl |
| HS Code | 2918300090 |
|---|
|
~%
Ethyl 3-(2,4-di... CAS#:174312-93-7 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 43, # 12 p. 2123 - 2132 |
|
~%
Ethyl 3-(2,4-di... CAS#:174312-93-7 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 43, # 12 p. 2123 - 2132 |
|
~%
Ethyl 3-(2,4-di... CAS#:174312-93-7 |
| Literature: Pharmaceutical Chemistry Journal, , vol. 31, # 5 p. 267 - 271 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl ester of (5-nitro-2,4-dichlorobenzoyl)acetic acid |
| 2,4-dichloro-5-nitrobenzoylacetic ester |
| ethyl 2,4-dichloro-5-nitrobenzoylacetate |