dimethyl 1,4-dihydro-2,6-dimethylpyridine-3,5-dicarboxylate structure
|
Common Name | dimethyl 1,4-dihydro-2,6-dimethylpyridine-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 17438-14-1 | Molecular Weight | 225.24100 | |
| Density | 1.147g/cm3 | Boiling Point | 321.9ºC at 760mmHg | |
| Molecular Formula | C11H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.5ºC | |
| Name | dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 321.9ºC at 760mmHg |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24100 |
| Flash Point | 148.5ºC |
| Exact Mass | 225.10000 |
| PSA | 64.63000 |
| LogP | 1.20250 |
| Vapour Pressure | 0.000289mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | FKDYIXOYTANTSV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid dimethyl ester |
| dimethyl 1,4-dihydro-2,6-dimethylpyridine-3,5-dicarboxylate |
| methyl Hantzsch ester |
| 1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid dimethyl ester |
| 2,6-dimethyl-3,5-dimethoxycarbonyl-1,4-dihydropyridine |