2,2'-bipyridyl-4,4'-diphosphonic ethyl ester structure
|
Common Name | 2,2'-bipyridyl-4,4'-diphosphonic ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 174397-53-6 | Molecular Weight | 428.35600 | |
| Density | 1.255g/cm3 | Boiling Point | 553.43ºC at 760 mmHg | |
| Molecular Formula | C18H26N2O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.504ºC | |
| Name | 4-diethoxyphosphoryl-2-(4-diethoxyphosphorylpyridin-2-yl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 553.43ºC at 760 mmHg |
| Molecular Formula | C18H26N2O6P2 |
| Molecular Weight | 428.35600 |
| Flash Point | 288.504ºC |
| Exact Mass | 428.12700 |
| PSA | 116.46000 |
| LogP | 3.92640 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | BBFROMDCBUIPCU-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)c1ccnc(-c2cc(P(=O)(OCC)OCC)ccn2)c1 |
| HS Code | 2933399090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| TETRAETHYL 2,2'-BIPYRIDINE-4,4'-BISPHOSPHONATE |
| Tetraethyl [2,2'-bipyridine]-4,4'-diylbis(phosphonate) |
| 4,4'-(diethyl phosphonato)-2,2'-bipyridine |
| tetraethyl 2,2'-bipyridine-4,4'-diyldiphosphonate |
| 4,4'-diethyl ester phosphonate-2,2'-bipyridine |
| 2,2'-bipyridyl-4,4'-diphosphonic ethyl ester |
| 4,4'-bis(diethylphosphonate)-2,2'-bipyridine |
| 2,2'-bipyridine-4,4'-(diethyl phosphonate) |