2-Bromo-5-methoxy-3-methylbenzoic acid structure
|
Common Name | 2-Bromo-5-methoxy-3-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 174417-54-0 | Molecular Weight | 245.070 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 353.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H9BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.4±27.9 °C | |
| Name | 2-bromo-5-methoxy-3-methylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 353.2±42.0 °C at 760 mmHg |
| Molecular Formula | C9H9BrO3 |
| Molecular Weight | 245.070 |
| Flash Point | 167.4±27.9 °C |
| Exact Mass | 243.973495 |
| PSA | 46.53000 |
| LogP | 2.99 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | OEHDWSKLTWRFOM-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c(Br)c(C(=O)O)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid, 2-bromo-5-methoxy-3-methyl- |
| 2-Bromo-5-methoxy-3-methylbenzoic acid |
| 2-bromo-5-methoxy-3-methyl-benzoic acid |