5,5-dimethyl-1-trimethylsilylhex-1-yn-3-one
Modify Date: 2025-09-12 12:28:43
5,5-dimethyl-1-trimethylsilylhex-1-yn-3-one structure
|
Common Name | 5,5-dimethyl-1-trimethylsilylhex-1-yn-3-one | ||
|---|---|---|---|---|
| CAS Number | 174459-14-4 | Molecular Weight | 196.36100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5-dimethyl-1-trimethylsilylhex-1-yn-3-one |
|---|
| Molecular Formula | C11H20OSi |
|---|---|
| Molecular Weight | 196.36100 |
| Exact Mass | 196.12800 |
| PSA | 17.07000 |
| LogP | 2.87250 |
| InChIKey | BBGZMOIHBJAQTL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)C#C[Si](C)(C)C |
|
~%
5,5-dimethyl-1-... CAS#:174459-14-4 |
| Literature: Heiss, Christian; Phillips, Robert S. Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 16 p. 2821 - 2825 |
