Fluazolate structure
|
Common Name | Fluazolate | ||
|---|---|---|---|---|
| CAS Number | 174514-07-9 | Molecular Weight | 443.61900 | |
| Density | 1.62g/cm3 | Boiling Point | 434.7ºC at 760mmHg | |
| Molecular Formula | C15H12BrClF4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
Use of FluazolateFluazolate is a herbicide for pre-emergence control of broad-leaved weeds and grasses. |
| Name | fluazolate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 434.7ºC at 760mmHg |
| Molecular Formula | C15H12BrClF4N2O2 |
| Molecular Weight | 443.61900 |
| Flash Point | 216.7ºC |
| Exact Mass | 441.97100 |
| PSA | 44.12000 |
| LogP | 5.22610 |
| Vapour Pressure | 9.3E-08mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | FKLQIONHGSFYJY-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)c1cc(-c2nn(C)c(C(F)(F)F)c2Br)c(F)cc1Cl |
| propan-2-yl 5-[4-bromo-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-chloro-4-fluorobenzoate |
| Fluazolate |
| Twin-Agro |
| UNII-KJX9P1E61K |
| Isopropazol |
| propan-2-yl 5-[4-bromo-1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-chloro-4-fluorobenzoate |
| isopropazol |
| 1-methylethyl 5-[4-bromo-1-methyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]-2-chloro-4-fluorobenzoate |
| isopropyl 5-[4-bromo-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-chloro-4-fluorobenzoate |
| JV 485 |