(E)-4-Hydroxytamoxifen structure
|
Common Name | (E)-4-Hydroxytamoxifen | ||
|---|---|---|---|---|
| CAS Number | 174592-47-3 | Molecular Weight | 387.51400 | |
| Density | 1.092g/cm3 | Boiling Point | 514.4ºC at 760 mmHg | |
| Molecular Formula | C26H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.9ºC | |
Use of (E)-4-Hydroxytamoxifen(E)-4-Hydroxytamoxifen, the less active isomer of (Z)-4-hydroxytamoxifen, is an estrogen receptor modulator. |
| Name | cis-4-Hydroxy Tamoxifen Discontinued |
|---|---|
| Synonym | More Synonyms |
| Description | (E)-4-Hydroxytamoxifen, the less active isomer of (Z)-4-hydroxytamoxifen, is an estrogen receptor modulator. |
|---|---|
| Related Catalog | |
| Target |
Estrogen receptor |
| Density | 1.092g/cm3 |
|---|---|
| Boiling Point | 514.4ºC at 760 mmHg |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.51400 |
| Flash Point | 264.9ºC |
| Exact Mass | 387.22000 |
| PSA | 32.70000 |
| LogP | 5.70170 |
| Vapour Pressure | 3.35E-11mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | TXUZVZSFRXZGTL-OCEACIFDSA-N |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCN(C)C)cc1)c1ccccc1 |
| 4-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |