[(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester
Modify Date: 2025-08-29 00:54:51
![[(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester Structure](https://www.chemsrc.com/extcaspic/219/174635-54-2.png)
[(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester structure
|
Common Name | [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 174635-54-2 | Molecular Weight | 426.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester |
|---|
| Molecular Formula | C26H22N2O4 |
|---|---|
| Molecular Weight | 426.5 |
| InChIKey | LOUYRLGPBWKDEG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(NC(=O)c1cc(-c2ccccc2)nc2cc(OC)ccc12)c1ccccc1 |
|
Name: Inhibition of [125I]-MePhe7-Neurokinin B (NKB) binding in human Tachykinin receptor 3...
Source: ChEMBL
Target: Neuromedin-K receptor
External Id: CHEMBL811270
|
Total 1, Current Page 1 of 1
1