[(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester
Modify Date: 2026-07-07 14:50:12
![[(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester Structure](https://www.chemsrc.com/extcaspic/219/174635-54-2.png)
[(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester structure
|
Common Name | [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 174635-54-2 | Molecular Weight | 426.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H22N2O4 |
|---|---|
| Molecular Weight | 426.5 |
| InChIKey | LOUYRLGPBWKDEG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(NC(=O)c1cc(-c2ccccc2)nc2cc(OC)ccc12)c1ccccc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of [125I]-MePhe7-Neurokinin B (NKB) binding in human Tachykinin receptor 3...
Source: ChEMBL
Target: Neuromedin-K receptor
External Id: CHEMBL811270
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester? |
| A: SMILES notation of [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester is COC(=O)C(NC(=O)c1cc(-c2ccccc2)nc2cc(OC)ccc12)c1ccccc1. |
| Q: What is the InChIKey of [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester? |
| A: InChIKey of [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester is LOUYRLGPBWKDEG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester? |
| A: Molecular weight of [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester is 426.5. |
| Q: What is the molecular formula of [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester? |
| A: Molecular formula of [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester is C26H22N2O4. |
| Q: What is the CAS number of [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester? |
| A: CAS number of [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester is 174635-54-2. |
| Q: What is the English name of [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester? |
| A: The English name of [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester is [(7-Methoxy-2-phenyl-quinoline-4-carbonyl)-amino]-phenyl-acetic acid methyl ester. |
| Q: What is the Chinese name of 174635-54-2? |
| A: Chinese name of 174635-54-2 is 174635-54-2. |