3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide
Modify Date: 2026-07-14 17:26:38
![3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide Structure](https://www.chemsrc.com/extcaspic/457/174635-70-2.png)
3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide structure
|
Common Name | 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 174635-70-2 | Molecular Weight | 380.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H24N2O |
|---|---|
| Molecular Weight | 380.5 |
| InChIKey | MQNYRKWJSMQECI-JOCHJYFZSA-N |
| SMILES | CCC(NC(=O)c1c(C)c(-c2ccccc2)nc2ccccc12)c1ccccc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Binding affinity towards cloned human Tachykinin receptor 3 (hNK-3) expressed in CHO ...
Source: ChEMBL
Target: Neuromedin-K receptor
External Id: CHEMBL811267
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide? |
| A: The English name of 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide is 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide. |
| Q: What is the Chinese name of 174635-70-2? |
| A: Chinese name of 174635-70-2 is 174635-70-2. |
| Q: What is the molecular weight of 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide? |
| A: Molecular weight of 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide is 380.5. |
| Q: What is the CAS number of 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide? |
| A: CAS number of 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide is 174635-70-2. |
| Q: What is the SMILES notation of 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide? |
| A: SMILES notation of 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide is CCC(NC(=O)c1c(C)c(-c2ccccc2)nc2ccccc12)c1ccccc1. |
| Q: What is the molecular formula of 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide? |
| A: Molecular formula of 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide is C26H24N2O. |
| Q: What is the InChIKey of 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide? |
| A: InChIKey of 3-Methyl-2-phenyl-N-[(1R)-1-phenylpropyl]-4-quinolinecarboxamide is MQNYRKWJSMQECI-JOCHJYFZSA-N. |