nicotinic acid, compound with 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline (1:1) structure
|
Common Name | nicotinic acid, compound with 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline (1:1) | ||
|---|---|---|---|---|
| CAS Number | 1748-09-0 | Molecular Weight | 462.49400 | |
| Density | N/A | Boiling Point | 483.2ºC at 760 mmHg | |
| Molecular Formula | C26H26N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.2ºC | |
| Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline,pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 483.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.49400 |
| Flash Point | 172.2ºC |
| Exact Mass | 462.17900 |
| PSA | 100.00000 |
| LogP | 4.63980 |
| Vapour Pressure | 5.01E-09mmHg at 25°C |
| InChIKey | NPAQBIPXGQGMRE-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cc2nccc3cc(OC)c(OC)cc23)cc1OC.O=C(O)c1cccnc1 |
| Nicotinic acid,compound with 1-((3,4-dimethoxyphenyl)methyl)-6,7-dimethoxyisoquinoline (1:1) |
| 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline |
| EINECS 217-132-1 |