tert-Butyl 4-[2-(aminomethyl)phenyl]piperazine-1-carboxylate structure
|
Common Name | tert-Butyl 4-[2-(aminomethyl)phenyl]piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 174855-53-9 | Molecular Weight | 291.38900 | |
| Density | 1.121g/cm3 | Boiling Point | 430.4ºC at 760mmHg | |
| Molecular Formula | C16H25N3O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 214.1ºC | |
| Name | tert-Butyl 4-[2-(aminomethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.121g/cm3 |
|---|---|
| Boiling Point | 430.4ºC at 760mmHg |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.38900 |
| Flash Point | 214.1ºC |
| Exact Mass | 291.19500 |
| PSA | 58.80000 |
| LogP | 2.90560 |
| Vapour Pressure | 1.3E-07mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | UINNZXQKTNAOBL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccccc2CN)CC1 |
| Water Solubility | Slightly soluble (5.8 g/L) (25 ºC) |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| TERT-BUTYL 4-[2-(AMINOMETHYL)PHENYL]PIPERAZINE-1-CARBOXYLATE |
| tert-Butyl 4-(2-(aminomethyl)phenyl)piperazine-1-carboxylate |
| 4-[2-(Aminomethyl)phenyl]-1-piperazinecarboxylic acid 1,1-dimethylethyl ester |
| 1-Boc-4-[2-(aminomethyl)phenyl]piperazine |