BDP R6G carboxylic acid structure
|
Common Name | BDP R6G carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 174881-57-3 | Molecular Weight | 340.132 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15BF2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDP R6G carboxylic acidBDP R6G carboxylic acid is a borondipyrromethene dye (Excitation: 530 nM; Emission: 548 nM). BDP R6G carboxylic acid terminal carboxylic acid can react with primary amine groups in the presence of activators to form a stable amide bond, for subsequent labeling reactions like Steglich esterification[1]. |
| Name | BODIPY R6G |
|---|---|
| Synonym | More Synonyms |
| Description | BDP R6G carboxylic acid is a borondipyrromethene dye (Excitation: 530 nM; Emission: 548 nM). BDP R6G carboxylic acid terminal carboxylic acid can react with primary amine groups in the presence of activators to form a stable amide bond, for subsequent labeling reactions like Steglich esterification[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H15BF2N2O2 |
|---|---|
| Molecular Weight | 340.132 |
| Exact Mass | 340.119476 |
| InChIKey | RFLLOBSXBJAGST-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc2n1[B-](F)(F)[N+]1=C(c3ccccc3)C=CC1=C2 |
| BODIPY R6G |
| Boron, difluoro[2-[(5-phenyl-1H-pyrrol-2-yl-κN)methylene]-2H-pyrrole-5-propanoato-κN1]- |
| Difluoro(3-{2-[(5-phenyl-1H-pyrrol-2-yl-κN)methylene]-2H-pyrrol-5-yl-κN}propanoato)boron |