4-Chloro-N-(4-methoxyphenyl)-1,2-benzenediamine structure
|
Common Name | 4-Chloro-N-(4-methoxyphenyl)-1,2-benzenediamine | ||
|---|---|---|---|---|
| CAS Number | 1750-94-3 | Molecular Weight | 248.70800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-1-N-(4-methoxyphenyl)benzene-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13ClN2O |
|---|---|
| Molecular Weight | 248.70800 |
| Exact Mass | 248.07200 |
| PSA | 47.28000 |
| LogP | 4.32860 |
| InChIKey | DDJBOLQRVULTTG-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2ccc(Cl)cc2N)cc1 |
| HS Code | 2922299090 |
|---|
|
~%
4-Chloro-N-(4-m... CAS#:1750-94-3 |
| Literature: Takeda Pharmaceutical Company Limited Patent: EP1810677 A1, 2007 ; Location in patent: Page/Page column 43 ; EP 1810677 A1 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-4-chlor-4'-methoxy-diphenylamin |
| 4-Chloro-N1-(4-methoxyphenyl)benzene-1,2-diamine |
| 4-Chloro-N-(4-methoxyphenyl)-1,2-benzenediamine |