2,4,6-triamino-5-chloroquinazoline structure
|
Common Name | 2,4,6-triamino-5-chloroquinazoline | ||
|---|---|---|---|---|
| CAS Number | 17511-20-5 | Molecular Weight | 209.63600 | |
| Density | 1.627g/cm3 | Boiling Point | 555.4ºC at 760mmHg | |
| Molecular Formula | C8H8ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.7ºC | |
| Name | 5-chloroquinazoline-2,4,6-triamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.627g/cm3 |
|---|---|
| Boiling Point | 555.4ºC at 760mmHg |
| Molecular Formula | C8H8ClN5 |
| Molecular Weight | 209.63600 |
| Flash Point | 289.7ºC |
| Exact Mass | 209.04700 |
| PSA | 103.84000 |
| LogP | 2.77340 |
| Vapour Pressure | 2.26E-12mmHg at 25°C |
| Index of Refraction | 1.857 |
| InChIKey | JZWXVYNQIJJTKF-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c2c(Cl)c(N)ccc2n1 |
| HS Code | 2933990090 |
|---|
|
~%
2,4,6-triamino-... CAS#:17511-20-5 |
| Literature: FMC Corporation Patent: US5534518 A1, 1996 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Concentration required for inhibition of rat liver dihydrofolate reductase (DHFR)
Source: ChEMBL
Target: Dihydrofolate reductase
External Id: CHEMBL666238
|
|
Name: Inhibition of liver dihydrofolate reductase (unknown origin)
Source: ChEMBL
Target: Dihydrofolate reductase
External Id: CHEMBL3280748
|
| 2,4,6-Triamino-5-chlorchinazolin |
| 5-chloro-2,4,6-triaminoquinazoline |
| 2,4,6-Triamino-5-chloro-chinazolin |
| 5-CHLORYL-2,4,6-QUINAZOLINETRIAMINE |
| 2,4,6-triamino-5-chloroquinazoline |
| CLZ |
| 5-chloro-quinazoline-2,4,6-triamine |