3-Chloro-2,6-dimethoxy-5-nitrobenzamide structure
|
Common Name | 3-Chloro-2,6-dimethoxy-5-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 175135-58-7 | Molecular Weight | 260.63100 | |
| Density | 1.448g/cm3 | Boiling Point | 337ºC at 760 mmHg | |
| Molecular Formula | C9H9ClN2O5 | Melting Point | 127ºC | |
| MSDS | N/A | Flash Point | 157.6ºC | |
| Name | 3-Chloro-2,6-dimethoxy-5-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.448g/cm3 |
|---|---|
| Boiling Point | 337ºC at 760 mmHg |
| Melting Point | 127ºC |
| Molecular Formula | C9H9ClN2O5 |
| Molecular Weight | 260.63100 |
| Flash Point | 157.6ºC |
| Exact Mass | 260.02000 |
| PSA | 108.36000 |
| LogP | 2.77170 |
| Vapour Pressure | 0.000108mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | XHJGSTYWRKCRFP-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)cc([N+](=O)[O-])c(OC)c1C(N)=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms546a14 |