2-(4-methylphenoxy)pyridine-3-carboxamide structure
|
Common Name | 2-(4-methylphenoxy)pyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 175135-81-6 | Molecular Weight | 228.24700 | |
| Density | 1.212g/cm3 | Boiling Point | 401.7ºC at 760mmHg | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methylphenoxy)pyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 401.7ºC at 760mmHg |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.24700 |
| Exact Mass | 228.09000 |
| PSA | 65.21000 |
| LogP | 2.98150 |
| Vapour Pressure | 1.16E-06mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | UDPIXPRXGOYJKB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Oc2ncccc2C(N)=O)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-methylphenoxy)nicotinamide |
| HMS546J08 |
| 2-(2-TRIFLUOROMETHYL)PYRIDINEMETHANAMINE |