1-[4-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]ethanone structure
|
Common Name | 1-[4-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 175136-25-1 | Molecular Weight | 340.15800 | |
| Density | 1.409g/cm3 | Boiling Point | 478.1ºC at 760 mmHg | |
| Molecular Formula | C15H11Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243ºC | |
| Name | 1-[4-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]ethanone |
|---|
| Density | 1.409g/cm3 |
|---|---|
| Boiling Point | 478.1ºC at 760 mmHg |
| Molecular Formula | C15H11Cl2NO4 |
| Molecular Weight | 340.15800 |
| Flash Point | 243ºC |
| Exact Mass | 339.00700 |
| PSA | 72.12000 |
| LogP | 5.20640 |
| Vapour Pressure | 2.64E-09mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | DSHDOBQVSBMJGA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OCc2ccc(Cl)c(Cl)c2)c([N+](=O)[O-])c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Antileishmanial activity against Leishmania donovani axenic amastigotes
Source: ChEMBL
Target: Leishmania donovani
External Id: CHEMBL853376
|