3,4'-DIMETHYL[1,1'-BIPHENYL]-4-OL structure
|
Common Name | 3,4'-DIMETHYL[1,1'-BIPHENYL]-4-OL | ||
|---|---|---|---|---|
| CAS Number | 175136-31-9 | Molecular Weight | 198.26000 | |
| Density | 1.067g/cm3 | Boiling Point | 320.1ºC at 760 mmHg | |
| Molecular Formula | C14H14O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.9ºC | |
| Name | 2-methyl-4-(4-methylphenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.067g/cm3 |
|---|---|
| Boiling Point | 320.1ºC at 760 mmHg |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26000 |
| Flash Point | 151.9ºC |
| Exact Mass | 198.10400 |
| PSA | 20.23000 |
| LogP | 3.67600 |
| Vapour Pressure | 0.000174mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | BNZOPTDFDBYNAD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ccc(O)c(C)c2)cc1 |
| HS Code | 2907199090 |
|---|
|
~47%
3,4'-DIMETHYL[1... CAS#:175136-31-9 |
| Literature: Organic Letters, , vol. 14, # 4 p. 1172 - 1175 |
|
~%
3,4'-DIMETHYL[1... CAS#:175136-31-9 |
| Literature: Journal of the Indian Chemical Society, , vol. 12, p. 410,413 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907199090 |
|---|---|
| Summary | 2907199090 other monophenols VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-methyl-4-(p-tolyl)phenol |
| HMS1410J20 |
| 3,4'-Dimethyl-biphenyl-4-ol |
| T0505-4876 |
| 4-Hydroxy-3.4'-dimethyl-biphenyl |
| 3,4'-dimethyl-(1,1'-biphenyl)-4-ol |