3-(2,6-DICHLOROBENZYL)PENTANE-2,4-DIONE structure
|
Common Name | 3-(2,6-DICHLOROBENZYL)PENTANE-2,4-DIONE | ||
|---|---|---|---|---|
| CAS Number | 175136-81-9 | Molecular Weight | 259.12800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(2,6-dichlorophenyl)methyl]pentane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12Cl2O2 |
|---|---|
| Molecular Weight | 259.12800 |
| Exact Mass | 258.02100 |
| PSA | 34.14000 |
| LogP | 3.33010 |
| InChIKey | JJHUBEFIMHFCRR-UHFFFAOYSA-N |
| SMILES | CC(=O)C(Cc1c(Cl)cccc1Cl)C(C)=O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 5m-721 |