3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine structure
|
Common Name | 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 175140-31-5 | Molecular Weight | 326.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine |
|---|
| Molecular Formula | C21H30N2O |
|---|---|
| Molecular Weight | 326.5 |
| InChIKey | NOVMRCQAXSODAQ-UHFFFAOYSA-N |
| SMILES | CCC(CC)OC1=C(C(=NC(=C1)C)NC2=C(C=C(C=C2C)C)C)C |
|
Name: Ex vivo displacement of [125I]oCRF from CRF1 receptor in Sprague-Dawley rat brain cor...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL935141
|
|
Name: Ex vivo displacement of [125I]oCRF from CRF1 receptor in Sprague-Dawley rat pituitary...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL935142
|
|
Name: Displacement of [125I]oCRF from rat CRF1 after 2 hrs by Betaplate scintillation count...
Source: ChEMBL
Target: Corticotropin-releasing factor receptor 1
External Id: CHEMBL935136
|