3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine
Modify Date: 2026-04-13 03:51:39
3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine structure
|
Common Name | 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 175140-31-5 | Molecular Weight | 326.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H30N2O |
|---|---|
| Molecular Weight | 326.5 |
| InChIKey | NOVMRCQAXSODAQ-UHFFFAOYSA-N |
| SMILES | CCC(CC)OC1=C(C(=NC(=C1)C)NC2=C(C=C(C=C2C)C)C)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Ex vivo displacement of [125I]oCRF from CRF1 receptor in Sprague-Dawley rat brain cor...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL935141
|
|
Name: Ex vivo displacement of [125I]oCRF from CRF1 receptor in Sprague-Dawley rat pituitary...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL935142
|
|
Name: Displacement of [125I]oCRF from rat CRF1 after 2 hrs by Betaplate scintillation count...
Source: ChEMBL
Target: Corticotropin-releasing factor receptor 1
External Id: CHEMBL935136
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine? |
| A: Molecular formula of 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine is C21H30N2O. |
| Q: What is the CAS number of 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine? |
| A: CAS number of 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine is 175140-31-5. |
| Q: What is the English name of 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine? |
| A: The English name of 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine is 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine. |
| Q: What is the Chinese name of 175140-31-5? |
| A: Chinese name of 175140-31-5 is 175140-31-5. |
| Q: What is the molecular weight of 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine? |
| A: Molecular weight of 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine is 326.5. |
| Q: What is the InChIKey of 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine? |
| A: InChIKey of 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine is NOVMRCQAXSODAQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine? |
| A: SMILES notation of 3,6-dimethyl-4-(pentan-3-yloxy)-N-(2,4,6-trimethylphenyl)pyridin-2-amine is CCC(CC)OC1=C(C(=NC(=C1)C)NC2=C(C=C(C=C2C)C)C)C. |