ETHYL2-(4,6-DICHLORO-2-METHYLPYRIMIDIN-5-YL)ACETATE
ETHYL2-(4,6-DICHLORO-2-METHYLPYRIMIDIN-5-YL)ACETATE structure
|
Common Name | ETHYL2-(4,6-DICHLORO-2-METHYLPYRIMIDIN-5-YL)ACETATE | ||
|---|---|---|---|---|
| CAS Number | 175140-75-7 | Molecular Weight | 249.09400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10Cl2N2O2 |
|---|---|
| Molecular Weight | 249.09400 |
| Exact Mass | 248.01200 |
| PSA | 52.08000 |
| LogP | 2.19740 |
| InChIKey | CMHXVEKUGZXPMB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1c(Cl)nc(C)nc1Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:1886-34-6
CAS#:95-02-3![N-[(4-amino-2-methyl-5-pyrimidyl)methyl]thioformamide structure](https://image.chemsrc.com/caspic/012/31375-20-9.png)
CAS#:31375-20-9
CAS#:70-16-6This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate? |
| A: Related downstream products(CAS) of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate: 1886-34-6;95-02-3;31375-20-9;70-16-6. |
| Q: What is the CAS number of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate? |
| A: CAS number of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate is 175140-75-7. |
| Q: What is the English name of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate? |
| A: The English name of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate is ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate. |
| Q: What is the molecular formula of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate? |
| A: Molecular formula of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate is C9H10Cl2N2O2. |
| Q: What is the polar surface area (PSA) of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate? |
| A: Polar surface area (PSA) of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate is 52.08000. |
| Q: What is the SMILES notation of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate? |
| A: SMILES notation of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate is CCOC(=O)Cc1c(Cl)nc(C)nc1Cl. |
| Q: What is the LogP of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate? |
| A: LogP of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate is 2.19740. |
| Q: What is the Chinese name of 175140-75-7? |
| A: Chinese name of 175140-75-7 is 175140-75-7. |
| Q: What is the InChIKey of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate? |
| A: InChIKey of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate is CMHXVEKUGZXPMB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate? |
| A: Molecular weight of ethyl 2-(4,6-dichloro-2-methylpyrimidin-5-yl)acetate is 249.09400. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |