Ethyl4-oxo-2-(2,2,2-trifluoroacetyl)pentanoate structure
|
Common Name | Ethyl4-oxo-2-(2,2,2-trifluoroacetyl)pentanoate | ||
|---|---|---|---|---|
| CAS Number | 17515-66-1 | Molecular Weight | 240.17600 | |
| Density | 0.859g/cm3 | Boiling Point | 772.9ºC at 760 mmHg | |
| Molecular Formula | C9H11F3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.9ºC | |
| Name | 3-carbethoxy-1,1,1-trifluorohexane-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 0.859g/cm3 |
|---|---|
| Boiling Point | 772.9ºC at 760 mmHg |
| Molecular Formula | C9H11F3O4 |
| Molecular Weight | 240.17600 |
| Flash Point | 324.9ºC |
| Exact Mass | 240.06100 |
| PSA | 60.44000 |
| LogP | 1.27620 |
| Vapour Pressure | 7.14E-23mmHg at 25°C |
| Index of Refraction | 1.46 |
| InChIKey | FGEABMHTTHRIOZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(C)=O)C(=O)C(F)(F)F |
| Storage condition | 2-8°C |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 4-oxo-2-(2,2,2-trifluoroacetyl)valerate |
| ethyl 4-oxo-1,4-dihydropyrrolo[1,2-b]pyridazin-3-carboxyate |
| ETHYL 4-OXO-1,4-DIHYDROPYRROLO[1,2-B]PYRIDAZINE-3-CARBOXYLATE |
| ethyl 1,4-dihydro-4-oxopyrrolo<1,2-b>pyridazine-3-carboxylate |
| ethyl 4-oxo-2-(2,2,2-trifluoro-1-oxoethyl)pentanoate |
| 3-Carbaethoxy-1,1,1-trifluor-hexan-2,5-dion |