4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid
Modify Date: 2025-09-02 11:40:20
![4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid Structure](https://www.chemsrc.com/extcaspic/112/175153-35-2.png)
4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid structure
|
Common Name | 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 175153-35-2 | Molecular Weight | 238.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H10N2O2 |
|---|---|
| Molecular Weight | 238.24 |
| InChIKey | AHJHOESKCGHHPR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2cn3ccccc3n2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid? |
| A: SMILES notation of 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid is O=C(O)c1ccc(-c2cn3ccccc3n2)cc1. |
| Q: What is the molecular weight of 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid? |
| A: Molecular weight of 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid is 238.24. |
| Q: What is the molecular formula of 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid? |
| A: Molecular formula of 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid is C14H10N2O2. |
| Q: What is the English name of 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid? |
| A: The English name of 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid is 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid. |
| Q: What is the Chinese name of 175153-35-2? |
| A: Chinese name of 175153-35-2 is 175153-35-2. |
| Q: What is the InChIKey of 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid? |
| A: InChIKey of 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid is AHJHOESKCGHHPR-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid? |
| A: CAS number of 4-Imidazo[1,2-a]pyridin-2-yl-benzoic acid is 175153-35-2. |