4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid
Modify Date: 2025-09-11 17:20:46
![4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid Structure](https://www.chemsrc.com/extcaspic/074/175153-36-3.png)
4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid structure
|
Common Name | 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 175153-36-3 | Molecular Weight | 252.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H12N2O2 |
|---|---|
| Molecular Weight | 252.27 |
| InChIKey | SKQGVWZAOHCONK-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(-c3ccc(C(=O)O)cc3)cn2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid? |
| A: Molecular formula of 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid is C15H12N2O2. |
| Q: What is the Chinese name of 175153-36-3? |
| A: Chinese name of 175153-36-3 is 175153-36-3. |
| Q: What is the English name of 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid? |
| A: The English name of 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid is 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid. |
| Q: What is the SMILES notation of 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid? |
| A: SMILES notation of 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid is Cc1ccc2nc(-c3ccc(C(=O)O)cc3)cn2c1. |
| Q: What is the CAS number of 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid? |
| A: CAS number of 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid is 175153-36-3. |
| Q: What is the InChIKey of 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid? |
| A: InChIKey of 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid is SKQGVWZAOHCONK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid? |
| A: Molecular weight of 4-(6-Methylimidazo[1,2-a]pyridin-2-yl)benzoic acid is 252.27. |