2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester
Modify Date: 2026-09-26 11:45:17
![2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester Structure](https://www.chemsrc.com/extcaspic/319/175159-67-8.png)
2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester structure
|
Common Name | 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester | ||
|---|---|---|---|---|
| CAS Number | 175159-67-8 | Molecular Weight | 350.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H23O8P |
|---|---|
| Molecular Weight | 350.30 |
| InChIKey | LBMQDIISWWRMME-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC(C)COP(=O)(O)OCC(C)OC(=O)C(=C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester? |
| A: The English name of 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester is 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester. |
| Q: What is the molecular weight of 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester? |
| A: Molecular weight of 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester is 350.30. |
| Q: What is the InChIKey of 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester? |
| A: InChIKey of 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester is LBMQDIISWWRMME-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester? |
| A: CAS number of 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester is 175159-67-8. |
| Q: What is the molecular formula of 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester? |
| A: Molecular formula of 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester is C14H23O8P. |
| Q: What is the Chinese name of 175159-67-8? |
| A: Chinese name of 175159-67-8 is 175159-67-8. |
| Q: What is the SMILES notation of 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester? |
| A: SMILES notation of 2-Propenoic acid, 2-methyl-, phosphinicobis[oxy(1-methyl-2,1-ethanediyl)] ester is C=C(C)C(=O)OC(C)COP(=O)(O)OCC(C)OC(=O)C(=C)C. |