Biscryptolepine
Modify Date: 2026-06-27 18:39:09
Biscryptolepine structure
|
Common Name | Biscryptolepine | ||
|---|---|---|---|---|
| CAS Number | 175178-79-7 | Molecular Weight | 462.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H22N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Biscryptolepine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C32H22N4 |
|---|---|
| Molecular Weight | 462.5 |
| InChIKey | GPXBTNAIIIXHOX-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=C3C1=C4C=CC=CC4=N3)C5=C6C(=C7C=CC=CC7=N6)N(C8=CC=CC=C85)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antimycobacterial activity against Mycobacterium fortuitum
Source: ChEMBL
Target: Mycolicibacterium fortuitum
External Id: CHEMBL5262767
|
|
Name: Antibacterial activity against Mycobacterium fortuitum ATCC 6841 measured after 24 hr...
Source: ChEMBL
Target: Mycolicibacterium fortuitum
External Id: CHEMBL5128129
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Biscryptolepine? |
| A: The English name of Biscryptolepine is Biscryptolepine. |
| Q: What is the SMILES notation of Biscryptolepine? |
| A: SMILES notation of Biscryptolepine is CN1C2=CC=CC=C2C(=C3C1=C4C=CC=CC4=N3)C5=C6C(=C7C=CC=CC7=N6)N(C8=CC=CC=C85)C. |
| Q: What is the CAS number of Biscryptolepine? |
| A: CAS number of Biscryptolepine is 175178-79-7. |
| Q: What is the molecular weight of Biscryptolepine? |
| A: Molecular weight of Biscryptolepine is 462.5. |
| Q: What is the Chinese name of 175178-79-7? |
| A: Chinese name of 175178-79-7 is 175178-79-7. |
| Q: What is the molecular formula of Biscryptolepine? |
| A: Molecular formula of Biscryptolepine is C32H22N4. |
| Q: What is the InChIKey of Biscryptolepine? |
| A: InChIKey of Biscryptolepine is GPXBTNAIIIXHOX-UHFFFAOYSA-N. |