methyl 4-hydroxyimino-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate structure
|
Common Name | methyl 4-hydroxyimino-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 175202-59-2 | Molecular Weight | 299.40900 | |
| Density | 1.35g/cm3 | Boiling Point | 477.4ºC at 760mmHg | |
| Molecular Formula | C13H17NO3S2 | Melting Point | 184ºC | |
| MSDS | N/A | Flash Point | 242.5ºC | |
| Name | methyl 4-hydroxyimino-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 477.4ºC at 760mmHg |
| Melting Point | 184ºC |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.40900 |
| Flash Point | 242.5ºC |
| Exact Mass | 299.06500 |
| PSA | 112.43000 |
| LogP | 3.40730 |
| Vapour Pressure | 6.39E-10mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | SJOCPYUKFOTDAN-RIYZIHGNSA-N |
| SMILES | COC(=O)c1sc(SC)c2c1CC(C)(C)CC2=NO |
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: HepG2-CD81
External Id: CHEMBL4483864
|
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: Plasmodium berghei
External Id: CHEMBL4483863
|
| methyl 4-hydroxyimino-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen |
| METHYL 6,6-DIMETHYL-4-HYDROXYIMINO-3-(METHYLTHIO)-4,5,6,7-TETRAHYDROBENZO(C)THIOPHENE-1-CARBOXYLATE |