2-(2-bromo-4,5-dichloroimidazol-1-yl)acetohydrazide structure
|
Common Name | 2-(2-bromo-4,5-dichloroimidazol-1-yl)acetohydrazide | ||
|---|---|---|---|---|
| CAS Number | 175202-83-2 | Molecular Weight | 287.92900 | |
| Density | 2.21g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H5BrCl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-bromo-4,5-dichloroimidazol-1-yl)acetohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.21g/cm3 |
|---|---|
| Molecular Formula | C5H5BrCl2N4O |
| Molecular Weight | 287.92900 |
| Exact Mass | 285.90200 |
| PSA | 72.94000 |
| LogP | 2.03350 |
| Index of Refraction | 1.743 |
| InChIKey | CLSJRUKRVVIGBT-UHFFFAOYSA-N |
| SMILES | NNC(=O)Cn1c(Br)nc(Cl)c1Cl |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2-bromo-4,5-dichloro-1H-imidazol-1-yl)ethanohydrazide |
| 2,7-BIS[2-(DIMETHYLAMINO)ETHOXY]-9H-FLUOREN-9-ONE DIHYDROCHLORIDE |