2,5-dichloro-4,6-dimethylpyridine-3-carboxamide structure
|
Common Name | 2,5-dichloro-4,6-dimethylpyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 175204-44-1 | Molecular Weight | 219.06800 | |
| Density | 1.388g/cm3 | Boiling Point | 255.3ºC at 760mmHg | |
| Molecular Formula | C8H8Cl2N2O | Melting Point | 172ºC | |
| MSDS | N/A | Flash Point | 108.2ºC | |
| Name | 2,5-dichloro-4,6-dimethylpyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388g/cm3 |
|---|---|
| Boiling Point | 255.3ºC at 760mmHg |
| Melting Point | 172ºC |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.06800 |
| Flash Point | 108.2ºC |
| Exact Mass | 218.00100 |
| PSA | 55.98000 |
| LogP | 2.80440 |
| Vapour Pressure | 0.0165mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | IHXGELAZSSLGOE-UHFFFAOYSA-N |
| SMILES | Cc1nc(Cl)c(C(N)=O)c(C)c1Cl |
| HS Code | 2933399090 |
|---|
|
~92%
2,5-dichloro-4,... CAS#:175204-44-1 |
| Literature: Dyadyuchenko; Strelkov; Mikhailichenko; Zaplishny Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 3 p. 308 - 314 |
|
~%
2,5-dichloro-4,... CAS#:175204-44-1 |
| Literature: Dyadyuchenko; Strelkov; Mikhailichenko; Zaplishny Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 3 p. 308 - 314 |
|
~%
2,5-dichloro-4,... CAS#:175204-44-1 |
| Literature: Dyadyuchenko; Strelkov; Mikhailichenko; Zaplishny Chemistry of Heterocyclic Compounds, 2004 , vol. 40, # 3 p. 308 - 314 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-DICHLOROPHENYLBORONIC ACID,PINACOL ESTER |
| 2,5-dichloro-4,6-dimethylnicotinamide |