4-(4-bromo-2-chloroanilino)-4-oxobut-2-enoic acid structure
|
Common Name | 4-(4-bromo-2-chloroanilino)-4-oxobut-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 175205-15-9 | Molecular Weight | 304.52400 | |
| Density | 1.771g/cm3 | Boiling Point | 494.3ºC at 760 mmHg | |
| Molecular Formula | C10H7BrClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.8ºC | |
| Name | 4-(4-bromo-2-chloroanilino)-4-oxobut-2-enoic acid |
|---|
| Density | 1.771g/cm3 |
|---|---|
| Boiling Point | 494.3ºC at 760 mmHg |
| Molecular Formula | C10H7BrClNO3 |
| Molecular Weight | 304.52400 |
| Flash Point | 252.8ºC |
| Exact Mass | 302.93000 |
| PSA | 66.40000 |
| LogP | 2.75480 |
| Vapour Pressure | 1.37E-10mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | ARCZKZYKNUNGNI-ONEGZZNKSA-N |
| SMILES | O=C(O)C=CC(=O)Nc1ccc(Br)cc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |