3-[(4-bromophenyl)methylideneamino]-2-sulfanylidene-thiazolidin-4-one structure
|
Common Name | 3-[(4-bromophenyl)methylideneamino]-2-sulfanylidene-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 17521-16-3 | Molecular Weight | 315.20900 | |
| Density | 1.7g/cm3 | Boiling Point | 407.6ºC at 760 mmHg | |
| Molecular Formula | C10H7BrN2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.3ºC | |
| Name | 3-[(4-bromophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 407.6ºC at 760 mmHg |
| Molecular Formula | C10H7BrN2OS2 |
| Molecular Weight | 315.20900 |
| Flash Point | 200.3ºC |
| Exact Mass | 313.91800 |
| PSA | 90.06000 |
| LogP | 2.58120 |
| Vapour Pressure | 7.46E-07mmHg at 25°C |
| Index of Refraction | 1.732 |
| InChIKey | IMCWYSDUWNZQPG-LFYBBSHMSA-N |
| SMILES | O=C1CSC(=S)N1N=Cc1ccc(Br)cc1 |
|
~%
3-[(4-bromophen... CAS#:17521-16-3 |
| Literature: Chemistry of Heterocyclic Compounds (New York, NY, United States), , vol. 7, p. 1111 - 1113 Khimiya Geterotsiklicheskikh Soedinenii, , vol. 7, p. 1182 - 1185 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(4-bromo-anilino)-2-thioxo-thiazolidin-4-one |
| 3-[(4-bromophenyl)amino]-2-thioxo-1,3-thiazolidin-4-one |
| 3-(4-Brom-anilino)-2-thioxo-thiazolidin-4-on |
| 3-(4-Brombenzylidenamino)rhodanin |
| 3-(4-bromo-benzylideneamino)-2-thioxo-thiazolidin-4-one |