Iodo-PK-11195 I-123
Modify Date: 2026-09-28 12:16:11
Iodo-PK-11195 I-123 structure
|
Common Name | Iodo-PK-11195 I-123 | ||
|---|---|---|---|---|
| CAS Number | 175236-01-8 | Molecular Weight | 440.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21IN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Iodo-PK-11195 I-123 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H21IN2O |
|---|---|
| Molecular Weight | 440.3 |
| InChIKey | PYUYMBOKENEYDV-NHTLRXQVSA-N |
| SMILES | CCC(C)N(C)C(=O)c1cc2ccccc2c(-c2ccccc2I)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Iodo-PK-11195 I-123? |
| A: InChIKey of Iodo-PK-11195 I-123 is PYUYMBOKENEYDV-NHTLRXQVSA-N. |
| Q: What is the molecular formula of Iodo-PK-11195 I-123? |
| A: Molecular formula of Iodo-PK-11195 I-123 is C21H21IN2O. |
| Q: What is the SMILES notation of Iodo-PK-11195 I-123? |
| A: SMILES notation of Iodo-PK-11195 I-123 is CCC(C)N(C)C(=O)c1cc2ccccc2c(-c2ccccc2I)n1. |
| Q: What is the English name of Iodo-PK-11195 I-123? |
| A: The English name of Iodo-PK-11195 I-123 is Iodo-PK-11195 I-123. |
| Q: What is the CAS number of Iodo-PK-11195 I-123? |
| A: CAS number of Iodo-PK-11195 I-123 is 175236-01-8. |
| Q: What is the Chinese name of 175236-01-8? |
| A: Chinese name of 175236-01-8 is 175236-01-8. |
| Q: What is the molecular weight of Iodo-PK-11195 I-123? |
| A: Molecular weight of Iodo-PK-11195 I-123 is 440.3. |