3,3'-(4-Methyl-1,3-phenylene)bis(1,1-dimethylurea) structure
|
Common Name | 3,3'-(4-Methyl-1,3-phenylene)bis(1,1-dimethylurea) | ||
|---|---|---|---|---|
| CAS Number | 17526-94-2 | Molecular Weight | 264.32400 | |
| Density | 1.204 g/cm3 | Boiling Point | 501ºC at 760 mmHg | |
| Molecular Formula | C13H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.8ºC | |
| Name | 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea |
|---|
| Density | 1.204 g/cm3 |
|---|---|
| Boiling Point | 501ºC at 760 mmHg |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.32400 |
| Flash Point | 256.8ºC |
| Exact Mass | 264.15900 |
| PSA | 64.68000 |
| LogP | 2.32800 |
| Vapour Pressure | 3.62E-10mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | KDQTUCKOAOGTLT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)N(C)C)cc1NC(=O)N(C)C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |