3,3'-(4-Methyl-1,3-phenylene)bis(1,1-dimethylurea)
3,3'-(4-Methyl-1,3-phenylene)bis(1,1-dimethylurea) structure
|
Common Name | 3,3'-(4-Methyl-1,3-phenylene)bis(1,1-dimethylurea) | ||
|---|---|---|---|---|
| CAS Number | 17526-94-2 | Molecular Weight | 264.32400 | |
| Density | 1.204 g/cm3 | Boiling Point | 501ºC at 760 mmHg | |
| Molecular Formula | C13H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.204 g/cm3 |
|---|---|
| Boiling Point | 501ºC at 760 mmHg |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.32400 |
| Flash Point | 256.8ºC |
| Exact Mass | 264.15900 |
| PSA | 64.68000 |
| LogP | 2.32800 |
| Vapour Pressure | 3.62E-10mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | KDQTUCKOAOGTLT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)N(C)C)cc1NC(=O)N(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea? |
| A: Boiling point of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea is 501ºC at 760 mmHg. |
| Q: What is the molecular weight of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea? |
| A: Molecular weight of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea is 264.32400. |
| Q: What is the CAS number of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea? |
| A: CAS number of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea is 17526-94-2. |
| Q: What is the LogP of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea? |
| A: LogP of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea is 2.32800. |
| Q: What is the polar surface area (PSA) of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea? |
| A: Polar surface area (PSA) of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea is 64.68000. |
| Q: What is the SMILES notation of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea? |
| A: SMILES notation of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea is Cc1ccc(NC(=O)N(C)C)cc1NC(=O)N(C)C. |
| Q: What is the English name of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea? |
| A: The English name of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea is 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea. |
| Q: What is the molecular formula of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea? |
| A: Molecular formula of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea is C13H20N4O2. |
| Q: What is the InChIKey of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea? |
| A: InChIKey of 3-[3-(dimethylcarbamoylamino)-4-methylphenyl]-1,1-dimethylurea is KDQTUCKOAOGTLT-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |