(S)-(-)-N-BENZYL-1-PHENYLETHYLAMINE structure
|
Common Name | (S)-(-)-N-BENZYL-1-PHENYLETHYLAMINE | ||
|---|---|---|---|---|
| CAS Number | 175277-08-4 | Molecular Weight | 210.27300 | |
| Density | 1.04g/cm3 | Boiling Point | 293.3ºC at 760mmHg | |
| Molecular Formula | C11H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.2ºC | |
| Name | ethyl 2-tert-butyl-5-methylpyrazole-3-carboxylate |
|---|
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 293.3ºC at 760mmHg |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.27300 |
| Flash Point | 131.2ºC |
| Exact Mass | 210.13700 |
| PSA | 44.12000 |
| LogP | 2.12320 |
| Vapour Pressure | 0.00174mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | KTNRGKIYKQZOOM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C)nn1C(C)(C)C |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |